| Name |
Peroxycostunolide Verlotorin |
| Formula |
C15H20O4 |
| Mw |
264.13615913 |
| CAS RN |
31105-79-0 |
| C_ID |
C00012179
, 
|
| InChIKey |
IXRHWRRLTANMPL-AUWXFJGCNA-N |
| InChICode |
InChI=1S/C15H20O4/c1-9-4-7-13(19-17)10(2)5-6-12-11(3)15(16)18-14(12)8-9/h8,12-14,17H,2-7H2,1H3/b9-8+/t12-,13+,14-/m0/s1 |
| SMILES |
C=C1CC[C@H]2C(=C)C(=O)O[C@@H]2/C=C(C)CC[C@H]1OO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia genipy | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Magnoliaceae | Magnolia grandiflora  | Ref. |
|
|
zoom in
| Organism | Laurus nobilis | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|