| Name |
Viguiestin |
| Formula |
C21H28O7 |
| Mw |
392.18350325 |
| CAS RN |
69440-10-4 |
| C_ID |
C00011869
, 
|
| InChIKey |
VDPIGPWXCXCBKE-CHEHALEXNA-N |
| InChICode |
InChI=1S/C21H28O7/c1-10(2)19(23)27-16-9-21(6)17(28-21)8-14(25-13(5)22)11(3)7-15-18(16)12(4)20(24)26-15/h7,10,14-18H,4,8-9H2,1-3,5-6H3/b11-7-/t14-,15-,16-,17-,18-,21-/m0/s1 |
| SMILES |
C=C1C(=O)O[C@@H]2/C=C(/C)[C@@H](OC(C)=O)C[C@@H]3O[C@@]3(C)C[C@H](OC(=O)C(C)C)[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Tithonia tagitiflora | Ref. |
| Plantae | Asteraceae | Viguiera stenoloba | Ref. |
|
|
zoom in
| Organism | Viguiera stenoloba | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|