| Name |
(+)-alpha-Atlantone (E)-alpha-Atlantone |
| Formula |
C15H22O |
| Mw |
218.16706532 |
| CAS RN |
26294-59-7 |
| C_ID |
C00011642
, 
|
| InChIKey |
OJEFBZMKKJTKKK-RRVGBUOJNA-N |
| InChICode |
InChI=1S/C15H22O/c1-11(2)9-15(16)10-13(4)14-7-5-12(3)6-8-14/h5,9-10,14H,6-8H2,1-4H3/b13-10+/t14-/m0/s1 |
| SMILES |
CC(C)=CC(=O)/C=C(C)[C@H]1CC=C(C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Pinaceae | Cedrus deodara  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|