| Name |
Turmerone (S)-2-Methyl-6-(4-methyl-1,4-cyclohexadien-1-yl)-2-hepten-4-one |
| Formula |
C15H22O |
| Mw |
218.16706532 |
| CAS RN |
56485-42-8 |
| C_ID |
C00011641
, 
|
| InChIKey |
FZPYMZUVXJUAQA-UGPWUYPHNA-N |
| InChICode |
InChI=1S/C15H22O/c1-11(2)9-15(16)10-13(4)14-7-5-12(3)6-8-14/h5,8-9,13H,6-7,10H2,1-4H3/t13-/m0/s1 |
| SMILES |
CC(C)=CC(=O)C[C@H](C)C1=CCC(C)=CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Curcuma aromatica  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma spp. | Ref. |
| Plantae | Zingiberaceae | Curcuma zedoaria  | Ref. |
|
|
zoom in
| Organism | Curcuma aromatica | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Calixto, et al., Planta Med, 69, (2003), 973 |
|---|
|