| Name |
Cytochalasin C |
| Formula |
C30H37NO6 |
| Mw |
507.26208792 |
| CAS RN |
22144-76-9 |
| C_ID |
C00011323
, 
|
| InChIKey |
NAIODHJWOHMDJX-UZIDCPFKNA-N |
| InChICode |
InChI=1S/C30H37NO6/c1-17-10-9-13-22-26(33)19(3)18(2)25-23(16-21-11-7-6-8-12-21)31-28(35)30(22,25)24(37-20(4)32)14-15-29(5,36)27(17)34/h6-9,11-15,17,22-26,33,36H,10,16H2,1-5H3,(H,31,35)/b13-9+,15-14+/t17-,22-,23-,24-,25-,26+,29+,30+/m0/s1 |
| SMILES |
CC(=O)O[C@H]1/C=C/[C@@](C)(O)C(=O)C(C)C/C=C/[C@H]2[C@H](O)C(C)=C(C)[C@H]3[C@H](Cc4ccccc4)NC(=O)[C@@]123 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Asp L-Phe L-His |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Clavicipitaceae | Metarhizium anisopliae | Ref. |
| Fungi | Xylariaceae | Hypoxylon terricola | Ref. |
|
|
zoom in
| Organism | Hypoxylon terricola | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Cole,Handbook of Toxic Fungal Metabolites,(1981),281
Nator,Mycotoxins and Phytoalexins,(1991),291 |
|---|
|