| Name |
TR-2 TR 2 toxin Verruculogen TR 2 |
| Formula |
C22H27N3O6 |
| Mw |
429.18998562 |
| CAS RN |
51177-07-2 |
| C_ID |
C00011301
, 
|
| InChIKey |
PIWNJAZCHHBADQ-VWHHWQMJNA-N |
| InChICode |
InChI=1S/C22H27N3O6/c1-21(2,29)10-15-17-16(12-7-6-11(31-3)9-13(12)23-17)18(26)22(30)20(28)24-8-4-5-14(24)19(27)25(15)22/h6-7,9,14-15,18,23,26,29-30H,4-5,8,10H2,1-3H3/t14-,15-,18-,22+/m0/s1 |
| SMILES |
COc1ccc2c3c([nH]c2c1)[C@H](CC(C)(C)O)N1C(=O)[C@@H]2CCCN2C(=O)[C@]1(O)[C@H]3O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp L-Pro |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
| Fungi | Trichocomaceae | Penicillium brasilianum | Ref. |
|
|
zoom in
| Organism | Penicillium brasilianum | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Cole,Handbook of Toxic Fungal Metabolites,(1981),377 |
|---|
|