| Name |
Fumitremorgin A |
| Formula |
C32H41N3O7 |
| Mw |
579.29445069 |
| CAS RN |
12626-18-5 |
| C_ID |
C00011296
, 
|
| InChIKey |
ACGHJVZDNQZJOV-MUJAYYATNA-N |
| InChICode |
InChI=1S/C32H41N3O7/c1-18(2)12-14-40-28-26-21-11-10-20(39-7)16-23(21)34-25(15-19(3)4)41-42-31(5,6)17-24(27(26)34)35-29(36)22-9-8-13-33(22)30(37)32(28,35)38/h10-12,15-16,22,24-25,28,38H,8-9,13-14,17H2,1-7H3/t22-,24-,25+,28-,32+/m0/s1 |
| SMILES |
COc1ccc2c3c4n(c2c1)[C@@H](C=C(C)C)OOC(C)(C)C[C@@H]4N1C(=O)[C@@H]2CCCN2C(=O)[C@]1(O)[C@H]3OCC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp L-Pro |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Trichocomaceae | Aspergillus caespitosus | Ref. |
| Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
| Fungi | Trichocomaceae | Penicillium janthinellum | Ref. |
| Fungi | Trichocomaceae | Penicillium piscarium | Ref. |
| - | - | Neosartaria fischeri | Ref. |
|
|
zoom in
| Organism | Aspergillus fumigatus | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Cole,Handbook of Toxic Fungal Metabolites,(1981),357 |
|---|
|