| Name |
Fumigaclavine B (8S,9S)-Fumigaclavine B |
| Formula |
C16H20N2O |
| Mw |
256.15756328 |
| CAS RN |
6879-93-2 |
| C_ID |
C00011248
, 
|
| InChIKey |
JUXRVSRUBIFVKE-PTKGSCQSNA-N |
| InChICode |
InChI=1S/C16H20N2O/c1-9-8-18(2)13-6-10-7-17-12-5-3-4-11(14(10)12)15(13)16(9)19/h3-5,7,9,13,15-17,19H,6,8H2,1-2H3/t9-,13+,15+,16-/m0/s1 |
| SMILES |
C[C@H]1CN(C)[C@@H]2Cc3c[nH]c4cccc(c34)[C@H]2[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Mucoraceae | Rhizopus oryzae | Ref. |
| Fungi | Trichocomaceae | Aspergillus fumigatus | Ref. |
| Fungi | Trichocomaceae | Aspergillus sydowi PFW1-13 | Ref. |
| Fungi | Trichocomaceae | Neosartorya fumigata | Ref. |
| Fungi | Trichocomaceae | Penicillium commune | Ref. |
| - | - | Aspergullus fumigatus | Ref. |
| - | - | Neosartarya fumigata Af293 | Ref. |
|
|
zoom in
| Organism | Aspergillus fumigatus | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Cole,Handbook of Toxic Fungal Metabolites,(1981),537
Berde,Handbook of Experimental Pharmacology,Springer-Verlag New York,(1978) |
|---|
|