| Name |
10-Hydroxyoleuropein |
| Formula |
C25H32O14 |
| Mw |
556.17920573 |
| CAS RN |
84638-44-8 |
| C_ID |
C00010786
, 
|
| InChIKey |
JCWFMPVGIIRRRG-IMYOZKAGNA-N |
| InChICode |
InChI=1S/C25H32O14/c1-35-23(34)15-11-37-24(39-25-22(33)21(32)20(31)18(10-27)38-25)13(4-6-26)14(15)9-19(30)36-7-5-12-2-3-16(28)17(29)8-12/h2-4,8,11,14,18,20-22,24-29,31-33H,5-7,9-10H2,1H3/b13-4+/t14-,18+,20+,21-,22-,24-,25-/m0/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](O[C@@H]2OC(CO)[C@@H](O)C(O)[C@@H]2O)/C(=C/CO)[C@@H]1CC(=O)OCCc1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Oleaceae | Fraxinus oxycarba | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Oleaceae | Jasminum multiflorum  | Ref. |
| Plantae | Oleaceae | Ligustrum japonicum  | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|