| Name |
Vebraside Verbraside |
| Formula |
C16H24O10 |
| Mw |
376.13694699 |
| CAS RN |
113358-20-6 |
| C_ID |
C00010725
, 
|
| InChIKey |
VFBJKEKWRZAYGB-YGDYXSDRNA-N |
| InChICode |
InChI=1S/C16H24O10/c1-4-5-3-23-15(8-7(5)13(9(4)18)25-14(8)22)26-16-12(21)11(20)10(19)6(2-17)24-16/h4-13,15-21H,2-3H2,1H3/t4-,5-,6-,7+,8-,9+,10+,11+,12+,13-,15+,16+/m1/s1 |
| SMILES |
C[C@@H]1C2CO[C@H](O[C@@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@H]3C(=O)O[C@@H](C1O)C23 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Verbenaceae | Verbena brasilensis | Ref. |
| Plantae | Verbenaceae | Verbena brasiliensis | Ref. |
|
|
zoom in
| Organism | Verbena brasiliensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|