| Name |
Eurostoside |
| Formula |
C24H28O12 |
| Mw |
508.15807636 |
| CAS RN |
85802-33-1 |
| C_ID |
C00010625
, 
|
| InChIKey |
SSFSGTBTPVWUPA-UJBYXYFXNA-N |
| InChICode |
InChI=1S/C24H28O12/c25-10-15-19(29)20(30)21(31)23(35-15)36-22-18-13(9-16(27)24(18,32)7-8-33-22)11-34-17(28)6-3-12-1-4-14(26)5-2-12/h1-9,15-16,18-23,25-27,29-32H,10-11H2/b6-3+/t15-,16+,18-,19+,20-,21-,22+,23-,24-/m0/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)OCC1=C[C@@H](O)[C@]2(O)C=COC(O[C@@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Orobanchaceae | Euphrasia rostkoviana  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
|
|
zoom in
| Organism | Scrophularia ningpoensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|