| Name |
Saccatoside 6-O-alpha-L-(2''-O-trans-p-coumaroyl)rhamnopyranosylcatalpol |
| Formula |
C30H38O16 |
| Mw |
654.21598517 |
| CAS RN |
85819-35-8 |
| C_ID |
C00010523
, 
|
| InChIKey |
XIPQZLUSSJDAIC-UMTMVBIXNA-N |
| InChICode |
InChI=1S/C30H38O16/c1-12-19(35)22(38)25(43-17(34)7-4-13-2-5-14(33)6-3-13)29(41-12)44-24-15-8-9-40-27(18(15)30(11-32)26(24)46-30)45-28-23(39)21(37)20(36)16(10-31)42-28/h2-9,12,15-16,18-29,31-33,35-39H,10-11H2,1H3/b7-4+/t12-,15-,16-,18+,19+,20+,21-,22+,23+,24-,25-,26-,27-,28-,29+,30+/m0/s1 |
| SMILES |
C[C@@H]1O[C@H](O[C@H]2[C@@H]3C=CO[C@@H](O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)[C@@H]3[C@@]3(CO)O[C@@H]23)C(OC(=O)/C=C/c2ccc(O)cc2)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Gmelina philippensis  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Scrophulariaceae | Verbascum saccatum | Ref. |
|
|
zoom in
| Organism | Scrophularia dentata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|