| Name |
Asystasioside E |
| Formula |
C15H23ClO10 |
| Mw |
398.09797467 |
| CAS RN |
126005-85-4 |
| C_ID |
C00010495
, 
|
| InChIKey |
MQVBIZWHELLSAW-ILYCFTKNNA-N |
| InChICode |
InChI=1S/C15H23ClO10/c16-12-8(19)5-1-2-24-13(7(5)15(12,23)4-18)26-14-11(22)10(21)9(20)6(3-17)25-14/h1-2,5-14,17-23H,3-4H2/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15+/m0/s1 |
| SMILES |
OCC1O[C@@H](O[C@@H]2OC=C[C@H]3[C@H](O)[C@@H](Cl)[C@@](O)(CO)[C@@H]23)[C@@H](O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Asystasia bella | Ref. |
| Plantae | Plantaginaceae | Veronica longifolia | Ref. |
| Plantae | Plantaginaceae | Wulfenia baldaccii Degen | Ref. |
|
|
zoom in
| Organism | Veronica longifolia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|