| Name |
5,7-Dihydroxy-6-(3-methylbut-2-enyl)-8-(3-methylbutyryl)-4-phenylcoumarin Mammea A/BA |
| Formula |
C25H26O5 |
| Mw |
406.17802394 |
| CAS RN |
5224-54-4 |
| C_ID |
C00010228
, 
|
| InChIKey |
SBHOAZQBEGVQLJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H26O5/c1-14(2)10-11-17-23(28)21-18(16-8-6-5-7-9-16)13-20(27)30-25(21)22(24(17)29)19(26)12-15(3)4/h5-10,13,15,28-29H,11-12H2,1-4H3 |
| SMILES |
CC(C)=CCc1c(O)c(C(=O)CC(C)C)c2oc(=O)cc(-c3ccccc3)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae-Guttiferae | Mammea africana  | Ref. |
| Plantae | Clusiaceae-Guttiferae | Mammea americana  | Ref. |
|
|
zoom in
| Organism | Mammea americana | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Crombie,J.Chem.Soc.C,(1967),2553
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Reutrakul, et al., Planta Med, 69, (2003), 1048 |
|---|
|