| Name |
Mammeigin 5-Hydroxy-6'',6''-dimethyl-6-(3-methylbutyryl)-4-phenylpyrano[2'',3'':7,8]coumarin Mammea A/A cyclo D |
| Formula |
C25H24O5 |
| Mw |
404.16237388 |
| CAS RN |
2289-11-4 |
| C_ID |
C00010221
, 
|
| InChIKey |
VSDJRZADBKXDHP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H24O5/c1-14(2)12-18(26)21-22(28)20-17(15-8-6-5-7-9-15)13-19(27)29-23(20)16-10-11-25(3,4)30-24(16)21/h5-11,13-14,28H,12H2,1-4H3 |
| SMILES |
CC(C)CC(=O)c1c2c(c3oc(=O)cc(-c4ccccc4)c3c1O)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae-Guttiferae | Mammea africana  | Ref. |
| Plantae | Clusiaceae-Guttiferae | Mammea americana  | Ref. |
| Plantae | Clusiaceae-Guttiferae | Mesua ferrea  | Ref. |
|
|
zoom in
| Organism | Mammea americana | | Reference | Bala, et al., Phytochemistry, 10, (1971), 1131.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Reutrakul, et al., Planta Med, 69, (2003), 1048
Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Finnegan,Chem.Ind.(London),(1964),1065
Crombie,J. Chem. Soc. C,(1967),2553 |
|---|
|