| Name |
Trifolirhizin Sophojaponicin B1 (-)-Maackiain 3-O-glucoside |
| Formula |
C22H22O10 |
| Mw |
446.12129692 |
| CAS RN |
6807-83-6 |
| C_ID |
C00010186
, 
|
| InChIKey |
VGSYCWGXBYZLLE-JSYCUEOGNA-N |
| InChICode |
InChI=1S/C22H22O10/c23-6-17-18(24)19(25)20(26)22(32-17)30-9-1-2-10-13(3-9)27-7-12-11-4-15-16(29-8-28-15)5-14(11)31-21(10)12/h1-5,12,17-26H,6-8H2/t12-,17+,18+,19-,20+,21-,22+/m0/s1 |
| SMILES |
OCC1O[C@@H](Oc2ccc3c(c2)OC[C@H]2c4cc5c(cc4O[C@@H]32)OCO5)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Baptisia australis | Ref. |
| Plantae | Fabaceae | Cicer spp. | Ref. |
| Plantae | Fabaceae | Euchresta formosana | Ref. |
| Plantae | Fabaceae | Euchresta japonica  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
| Plantae | Fabaceae | Ononis spinosa  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora subprostrata | Ref. |
| Plantae | Fabaceae | Tephrosia spp. | Ref. |
| Plantae | Fabaceae | Thermopsis spp. | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
|
|
zoom in
| Organism | Cicer spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Lebreton,Phytochem.,6,(1967),1675 |
|---|
|