| Name |
Biochanin A 7-O-glucoside Astroside Sissotrin |
| Formula |
C22H22O10 |
| Mw |
446.12129692 |
| CAS RN |
5928-26-7 |
| C_ID |
C00010112
, 
|
| InChIKey |
LFEUICHQZGNOHD-RSBVYOOMNA-N |
| InChICode |
InChI=1S/C22H22O10/c1-29-11-4-2-10(3-5-11)13-9-30-15-7-12(6-14(24)17(15)18(13)25)31-22-21(28)20(27)19(26)16(8-23)32-22/h2-7,9,16,19-24,26-28H,8H2,1H3/t16-,19-,20+,21-,22-/m1/s1 |
| SMILES |
COc1ccc(-c2coc3cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc(O)c3c2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Sophora japonica L.  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
|
|
zoom in
| Organism | Cicer arietinum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Wong,Phytochem.,4,(1965),89 |
|---|
|