| Name |
Formononetin 7-O-rutinoside Derriscanoside A |
| Formula |
C28H32O13 |
| Mw |
576.18429111 |
| CAS RN |
51351-35-0 |
| C_ID |
C00010081
, 
|
| InChIKey |
ZSCRYAYQFLBRDF-OEPCLMMTNA-N |
| InChICode |
InChI=1S/C28H32O13/c1-12-20(29)23(32)25(34)27(39-12)38-11-19-22(31)24(33)26(35)28(41-19)40-15-7-8-16-18(9-15)37-10-17(21(16)30)13-3-5-14(36-2)6-4-13/h3-10,12,19-20,22-29,31-35H,11H2,1-2H3/t12-,19-,20+,22+,23-,24+,25+,26-,27-,28-/m1/s1 |
| SMILES |
COc1ccc(-c2coc3cc(O[C@@H]4OC(CO[C@@H]5OC(C)[C@H](O)C(O)[C@@H]5O)[C@@H](O)[C@H](O)C4O)ccc3c2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Fabaceae | Dalbergia paniculata  | Ref. |
| Plantae | Fabaceae | Derris scandens  | Ref. |
|
|
zoom in
| Organism | Dalbergia paniculata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Parthasarathy,Indian J.Chem.,12,(1974),518 |
|---|
|