| Name |
Daidzein 7,4'-di-O-glucoside |
| Formula |
C27H30O14 |
| Mw |
578.16355567 |
| CAS RN |
53681-67-7 |
| C_ID |
C00010080
, 
|
| InChIKey |
VWEWSCDQMVNOJP-PKZOGTBJNA-N |
| InChICode |
InChI=1S/C27H30O14/c28-8-17-20(31)22(33)24(35)26(40-17)38-12-3-1-11(2-4-12)15-10-37-16-7-13(5-6-14(16)19(15)30)39-27-25(36)23(34)21(32)18(9-29)41-27/h1-7,10,17-18,20-29,31-36H,8-9H2/t17-,18+,20-,21+,22-,23-,24-,25+,26-,27+/m0/s1 |
| SMILES |
O=c1c(-c2ccc(O[C@H]3OC(CO)[C@H](O)C(O)C3O)cc2)coc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Maackia fauriei | Ref. |
| Plantae | Fabaceae | Piptanthus nepalensis | Ref. |
| Plantae | Fabaceae | Pueraria montana var. lobata | Ref. |
| Plantae | Fabaceae | Vigna angularis  | Ref. |
|
|
zoom in
| Organism | Piptanthus nepalensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Paris,Planta Med.,29,(1976),32
Kobayashi,Phytochem.,22,(1983),1257 |
|---|
|