| Name |
Puerarol 3,9-Dihydroxy-2-geranylcoumestan |
| Formula |
C25H24O5 |
| Mw |
404.16237388 |
| CAS RN |
155645-56-0 |
| C_ID |
C00010061
, 
|
| InChIKey |
CGMGCGYLRFAMQF-VIZOYTHASA-N |
| InChICode |
InChI=1S/C25H24O5/c1-14(2)5-4-6-15(3)7-8-16-11-19-22(13-20(16)27)30-25(28)23-18-10-9-17(26)12-21(18)29-24(19)23/h5,7,9-13,26-27H,4,6,8H2,1-3H3/b15-7+ |
| SMILES |
CC(C)=CCC/C(C)=C/Cc1cc2c(cc1O)oc(=O)c1c3ccc(O)cc3oc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Pueraria lobata  | Ref. |
| Plantae | Fabaceae | Pueraria spp. | Ref. |
| Plantae | Fabaceae | Pueraria thunbergiana  | Ref. |
|
|
zoom in
| Organism | Pueraria spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ohshima,Planta Med.,54,(1988),250 |
|---|
|