| Name |
Isoglycycoumarin |
| Formula |
C21H20O6 |
| Mw |
368.12598837 |
| CAS RN |
117038-82-1 |
| C_ID |
C00010041
, 
|
| InChIKey |
PHHAXWBLJNBVNS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H20O6/c1-21(2)7-6-13-18(27-21)10-17-15(19(13)25-3)9-14(20(24)26-17)12-5-4-11(22)8-16(12)23/h4-5,8-10,22-23H,6-7H2,1-3H3 |
| SMILES |
COc1c2c(cc3oc(=O)c(-c4ccc(O)cc4O)cc13)OC(C)(C)CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza aspera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza glabra | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Zeng,J.Chromatogr.,513,(1990),247 |
|---|
|