| Name |
8-Prenylluteone 5,7,2',4'-Tetrahydroxy-6,8-diprenylisoflavone |
| Formula |
C25H26O6 |
| Mw |
422.17293856 |
| CAS RN |
125002-91-7 |
| C_ID |
C00009940
, 
|
| InChIKey |
VYELCIXMHUBNAL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H26O6/c1-13(2)5-8-17-22(28)18(9-6-14(3)4)25-21(23(17)29)24(30)19(12-31-25)16-10-7-15(26)11-20(16)27/h5-7,10-12,26-29H,8-9H2,1-4H3 |
| SMILES |
CC(C)=CCc1c(O)c(CC=C(C)C)c2occ(-c3ccc(O)cc3O)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina burttii | Ref. |
| Plantae | Fabaceae | Erythrina eriotriocha | Ref. |
| Plantae | Fabaceae | Erythrina senegalensis  | Ref. |
| Plantae | Fabaceae | Erythrina vogelii | Ref. |
|
|
zoom in
| Organism | Erythrina eriotriocha | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Nkengfack,Phytochem.,28,(1989),2522 |
|---|
|