| Name |
Iriskashmirianin 4'-Hydroxy-5,3'-dimethoxy-6,7-methylenedioxyisoflavone |
| Formula |
C18H14O7 |
| Mw |
342.0739528 |
| CAS RN |
128700-90-3 |
| C_ID |
C00009862
, 
|
| InChIKey |
NENMWHDSDRXUKW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H14O7/c1-21-12-5-9(3-4-11(12)19)10-7-23-13-6-14-17(25-8-24-14)18(22-2)15(13)16(10)20/h3-7,19H,8H2,1-2H3 |
| SMILES |
COc1cc(-c2coc3cc4c(c(OC)c3c2=O)OCO4)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Iridaceae | Iris germanica  | Ref. |
| Plantae | Iridaceae | Iris kashmiriana | Ref. |
| Plantae | Iridaceae | Iris soforana | Ref. |
|
|
zoom in
| Organism | Iris kashmiriana | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Kachroo,Phytochem.,29,(1990),1014 |
|---|
|