| Name |
Coumestrol dimethyl ether Di-O-methylcoumestrol 3,9-Dimethylcoumestan 3,9-Dimethoxy-6-oxopterocarpene |
| Formula |
C17H12O5 |
| Mw |
296.06847349 |
| CAS RN |
3172-99-4 |
| C_ID |
C00009761
, 
|
| InChIKey |
PXHLPCBBXPHBHP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H12O5/c1-19-9-3-5-11-13(7-9)21-16-12-6-4-10(20-2)8-14(12)22-17(18)15(11)16/h3-8H,1-2H3 |
| SMILES |
COc1ccc2c(c1)oc(=O)c1c3ccc(OC)cc3oc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia decipularis | Ref. |
| Plantae | Fabaceae | Swartzia madagascariensis  | Ref. |
|
|
zoom in
| Organism | Swartzia madagascariensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
De Alencar,Phytochem.,11,(1972),1517
Harper,J.Chem.Soc.C,(1969),1109 |
|---|
|