| Name |
Claussequinone 7-Hydroxy-4'-methoxyisoflavanquinone |
| Formula |
C16H14O5 |
| Mw |
286.08412356 |
| CAS RN |
35878-39-8 |
| C_ID |
C00009741
, 
|
| InChIKey |
PDAKXMIQFUHWQC-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O5/c1-20-16-7-13(18)12(6-14(16)19)10-4-9-2-3-11(17)5-15(9)21-8-10/h2-3,5-7,10,17H,4,8H2,1H3/t10-/m0/s1 |
| SMILES |
COC1=CC(=O)C(C2COc3cc(O)ccc3C2)=CC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cyclolobium claussenii | Ref. |
| Plantae | Fabaceae | Cyclolobium vecchii | Ref. |
| Plantae | Fabaceae | Dalbergia candenatensis | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Millettia leucantha | Ref. |
| Plantae | Fabaceae | Millettia pendula | Ref. |
| Plantae | Fabaceae | Pterocarpus soyauxii  | Ref. |
| - | - | Cyclobium clausseni | Ref. |
| - | - | Cyclobium vecchi | Ref. |
| - | - | Milletia pendula | Ref. |
|
|
zoom in
| Organism | Cyclolobium vecchii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Gottlieb,Phytochem.,14,(1975),2495
Hayashi,J.Jpn Wood Res.Soc.,24,(1978),898 |
|---|
|