| Name |
Licoricidin 5,2',4'-Trihydroxy-7-methoxy-6,3'-diprenylisoflavan |
| Formula |
C26H32O5 |
| Mw |
424.22497413 |
| CAS RN |
30508-27-1 |
| C_ID |
C00009739
, 
|
| InChIKey |
HWJXKLRHGKKFBY-SOFGYWHQNA-N |
| InChICode |
InChI=1S/C26H32O5/c1-15(2)6-8-19-22(27)11-10-18(25(19)28)17-12-21-24(31-14-17)13-23(30-5)20(26(21)29)9-7-16(3)4/h6-8,10-11,13,15,17,27-29H,9,12,14H2,1-5H3/b8-6+/t17-/m0/s1 |
| SMILES |
COc1cc2c(c(O)c1CC=C(C)C)CC(c1ccc(O)c(/C=C/C(C)C)c1O)CO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza aspera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza glabra | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Shibata,Chem.Pharm.Bull.,16,(1968),1932 |
|---|
|