| Name |
Isosativan 2'-Hydroxy-7,4'-dimethoxyisoflavan |
| Formula |
C17H18O4 |
| Mw |
286.12050906 |
| CAS RN |
60102-29-6 |
| C_ID |
C00009711
, 
|
| InChIKey |
FWAWTPASGRNXTO-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H18O4/c1-19-13-5-6-15(16(18)8-13)12-7-11-3-4-14(20-2)9-17(11)21-10-12/h3-6,8-9,12,18H,7,10H2,1-2H3/t12-/m0/s1 |
| SMILES |
COc1ccc(C2COc3cc(OC)ccc3C2)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Medicago lupulina  | Ref. |
| Plantae | Fabaceae | Medicago radiata | Ref. |
| Plantae | Fabaceae | Medicago rugosa | Ref. |
| Plantae | Fabaceae | Medicago scutellata  | Ref. |
| Plantae | Fabaceae | Millettia dielsiana | Ref. |
| Plantae | Fabaceae | Trifolium spp. | Ref. |
|
|
zoom in
| Organism | Medicago radiata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|