| Name |
Equol 7,4'-Dihydroxyisoflavan |
| Formula |
C15H14O3 |
| Mw |
242.09429431 |
| CAS RN |
94105-90-5 |
| C_ID |
C00009707
, 
|
| InChIKey |
ADFCQWZHKCXPAJ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H14O3/c16-13-4-1-10(2-5-13)12-7-11-3-6-14(17)8-15(11)18-9-12/h1-6,8,12,16-17H,7,9H2/t12-/m1/s1 |
| SMILES |
Oc1ccc(C2COc3cc(O)ccc3C2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Fabaceae | Millettia pendula | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
|
|
zoom in
| Organism | Millettia pendula | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Hayashi,J.Jpn Wood Res.Soc.,24,(1978),898 |
|---|
|