| Name |
Glyceollin IV
6a,9-Dihydroxy-3-methoxy-2-prenylpterocarpan |
| Formula |
C21H22O5 |
| Mw |
354.14672381 |
| CAS RN |
69393-94-8 |
| C_ID |
C00009690
, 
|
| InChIKey |
WOKIXZBYDPTMJD-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C21H22O5/c1-12(2)4-5-13-8-15-18(10-17(13)24-3)25-11-21(23)16-7-6-14(22)9-19(16)26-20(15)21/h4,6-10,20,22-23H,5,11H2,1-3H3/t20-,21+/m0/s1 |
| SMILES |
COc1cc2c(cc1CC=C(C)C)C1Oc3cc(O)ccc3C1(O)CO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycine soja | Ref. |
| Plantae | Fabaceae | Psophocarpus tetragonolobus | Ref. |
|
|
zoom in
| Organism | Glycine soja |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Lyne,Tetrahedron Lett.,(1978),3127
Ingham,Phytochem.,20,(1981),795 |
|---|
|
