| Name |
Methylnissolin 3-Hydroxy-9,10-dimethoxypterocarpan |
| Formula |
C17H16O5 |
| Mw |
300.09977362 |
| CAS RN |
73340-41-7 |
| C_ID |
C00009617
, 
|
| InChIKey |
UOVGCLXUTLXAEC-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H16O5/c1-19-13-6-5-10-12-8-21-14-7-9(18)3-4-11(14)15(12)22-16(10)17(13)20-2/h3-7,12,15,18H,8H2,1-2H3/t12-,15-/m1/s1 |
| SMILES |
COc1ccc2c(c1OC)OC1c3ccc(O)cc3OCC21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Lathyrus nissolia | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
|
|
zoom in
| Organism | Lathyrus nissolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Robeson,Phytochem.,18,(1979),1715 |
|---|
|