| Name |
Pterocarpin 3-Methoxy-8,9-methylenedioxypterocarpan |
| Formula |
C17H14O5 |
| Mw |
298.08412356 |
| CAS RN |
524-97-0 |
| C_ID |
C00009616
, 
|
| InChIKey |
YLZYAUCOYZKLMA-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H14O5/c1-18-9-2-3-10-13(4-9)19-7-12-11-5-15-16(21-8-20-15)6-14(11)22-17(10)12/h2-6,12,17H,7-8H2,1H3/t12-,17-/m1/s1 |
| SMILES |
COc1ccc2c(c1)OCC1c3cc4c(cc3OC21)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Fabaceae | Baphia nitida  | Ref. |
| Plantae | Fabaceae | Ononis viscosa subsp. breviflora  | Ref. |
| Plantae | Fabaceae | Pterocarpus indicus  | Ref. |
| Plantae | Fabaceae | Pterocarpus osun | Ref. |
| Plantae | Fabaceae | Pterocarpus santalinus  | Ref. |
| Plantae | Fabaceae | Pterocarpus spp. | Ref. |
| Plantae | Fabaceae | Sophora angustifolia | Ref. |
| Plantae | Fabaceae | Sophora subprostrata | Ref. |
| Plantae | Fabaceae | Sophora substrata | Ref. |
| Plantae | Fabaceae | Swartzia madagascariensis  | Ref. |
| - | - | Onionis viscosa ssp. breviflora | Ref. |
|
|
zoom in
| Organism | Baphia nitida | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Cazeneuve,C.R.Acad.Sci.Paris,104,(1887),1722
Raudnitz,Ber.Dtsch.Chem.Ges.,68B,(1935),1862 |
|---|
|