| Name |
6beta-Acetylteuscordin Dehydromillettone 6a,12a-Didehydromillettone |
| Formula |
C22H16O6 |
| Mw |
376.09468824 |
| CAS RN |
43016-04-2 |
| C_ID |
C00009600
, 
|
| InChIKey |
JOEPOINDECTPQI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C22H16O6/c1-22(2)6-5-11-14(28-22)4-3-12-20(23)19-13-7-16-17(26-10-25-16)8-15(13)24-9-18(19)27-21(11)12/h3-8H,9-10H2,1-2H3 |
| SMILES |
CC1(C)C=Cc2c(ccc3c(=O)c4c(oc23)COc2cc3c(cc2-4)OCO3)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Millettia usaramensis subsp. usaramensis  | Ref. |
| Plantae | Fabaceae | Piscidia erythrina | Ref. |
| Plantae | Labiatae | Teucrium tomentosum | Ref. |
|
|
zoom in
| Organism | Piscidia erythrina | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Falshaw,Tetrahedron (Suppl.7),(1966),333 |
|---|
|