| Name |
12a-Hydroxymunduserone |
| Formula |
C19H18O7 |
| Mw |
358.10525293 |
| CAS RN |
66280-24-8 |
| C_ID |
C00009580
, 
|
| InChIKey |
APAWOEBSLLGWDF-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C19H18O7/c1-22-10-4-5-11-13(6-10)26-17-9-25-14-8-16(24-3)15(23-2)7-12(14)19(17,21)18(11)20/h4-8,17,21H,9H2,1-3H3/t17-,19-/m0/s1 |
| SMILES |
COc1ccc2c(c1)OC1COc3cc(OC)c(OC)cc3C1(O)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Millettia oblata ssp. teitensis  | Ref. |
| Plantae | Fabaceae | Pachyrrhizus erosus  | Ref. |
| Plantae | Fabaceae | Tephrosia fulvinervis | Ref. |
|
|
zoom in
| Organism | Pachyrrhizus erosus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Kalra,Indian J.Chem.Sect.B,15,(1977),1084 |
|---|
|