| Name |
Neotenone Neorautenone |
| Formula |
C19H14O6 |
| Mw |
338.07903818 |
| CAS RN |
10091-02-8 |
| C_ID |
C00009548
, 
|
| InChIKey |
JZNIBAUSQWDFGE-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C19H14O6/c1-21-15-7-18-17(24-9-25-18)5-11(15)13-8-23-16-6-14-10(2-3-22-14)4-12(16)19(13)20/h2-7,13H,8-9H2,1H3/t13-/m0/s1 |
| SMILES |
COc1cc2c(cc1C1COc3cc4occc4cc3C1=O)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Neorautanenia amboensis | Ref. |
| Plantae | Fabaceae | Neorautanenia edulis | Ref. |
| Plantae | Fabaceae | Neorautanenia mitis  | Ref. |
| Plantae | Fabaceae | Neorautanenia pseudopachyrrhiza | Ref. |
| Plantae | Fabaceae | Pachyrhizus erosus  | Ref. |
| Plantae | Fabaceae | Pachyrhizus tuberosus  | Ref. |
| Plantae | Fabaceae | Pachyrrhizus erosus  | Ref. |
|
|
zoom in
| Organism | Neorautanenia edulis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Crombie,Tetrahedron Lett.,(1962),801
Van Duuren,J.Org.Chem.,26,(1961),5013 |
|---|
|