| Name |
Violanone 7,3'-Dihydroxy-2',4'-dimethoxyisoflavanone |
| Formula |
C17H16O6 |
| Mw |
316.09468824 |
| CAS RN |
52250-38-1 |
| C_ID |
C00009542
, 
|
| InChIKey |
ILOKNKKFXJKHMB-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H16O6/c1-21-13-6-5-10(17(22-2)16(13)20)12-8-23-14-7-9(18)3-4-11(14)15(12)19/h3-7,12,18,20H,8H2,1-2H3/t12-/m0/s1 |
| SMILES |
COc1ccc(C2COc3cc(O)ccc3C2=O)c(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia oliveri | Ref. |
| Plantae | Fabaceae | Dalbergia violacea | Ref. |
|
|
zoom in
| Organism | Dalbergia oliveri | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Donnelly,Phytochem.,13,(1974),2587 |
|---|
|