| Name |
Onogenin 7-Hydroxy-2'-methoxy-4',5'-methylenedioxyisoflavanone |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
58116-57-7 |
| C_ID |
C00009541
, 
|
| InChIKey |
DZXJXYRRENIUNP-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H14O6/c1-20-13-6-16-15(22-8-23-16)5-11(13)12-7-21-14-4-9(18)2-3-10(14)17(12)19/h2-6,12,18H,7-8H2,1H3/t12-/m1/s1 |
| SMILES |
COc1cc2c(cc1C1COc3cc(O)ccc3C1=O)OCO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
| Plantae | Fabaceae | Ononis arvensis  | Ref. |
| Plantae | Fabaceae | Ulex airensis | Ref. |
| Plantae | Fabaceae | Ulex europaeus subsp. europaeus  | Ref. |
|
|
zoom in
| Organism | Ononis arvensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Donnelly,J.Chem.Soc.Perkin Trans,1,(1973),1737
Kovalev,Khim.Prir.Soedin.,(1975),354 |
|---|
|