| Name |
5,3',4',5'-Tetramethoxy-6,7-methylenedioxyisoflavone Irisflorentin |
| Formula |
C20H18O8 |
| Mw |
386.10016755 |
| CAS RN |
41743-73-1 |
| C_ID |
C00009490
, 
|
| InChIKey |
RISXUTCDCPHJFQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O8/c1-22-13-5-10(6-14(23-2)18(13)24-3)11-8-26-12-7-15-19(28-9-27-15)20(25-4)16(12)17(11)21/h5-8H,9H2,1-4H3 |
| SMILES |
COc1cc(-c2coc3cc4c(c(OC)c3c2=O)OCO4)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Iridaceae | Belamcanda chinensis  | Ref. |
| Plantae | Iridaceae | Iris dichotoma | Ref. |
| Plantae | Iridaceae | Iris florentina | Ref. |
| Plantae | Iridaceae | Iris germanica  | Ref. |
| Plantae | Iridaceae | Iris potaninii | Ref. |
| Plantae | Iridaceae | Iris tingitana | Ref. |
|
|
zoom in
| Organism | Iris dichotoma | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
ITO, et al., Chem Pharm Bull, 49, (2001), 1229 |
|---|
|