| Name |
Irigenin 5,7,3'-Trimethoxy-6,4',5'-trimethoxyisoflavone |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
548-76-5 |
| C_ID |
C00009485
, 
|
| InChIKey |
TUGWPJJTQNLKCL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-13-5-8(4-10(19)17(13)24-2)9-7-26-12-6-11(20)18(25-3)16(22)14(12)15(9)21/h4-7,19-20,22H,1-3H3 |
| SMILES |
COc1cc(-c2coc3cc(O)c(OC)c(O)c3c2=O)cc(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia nervosa  | Ref. |
| Plantae | Cupressaceae | Juniperus macropoda | Ref. |
| Plantae | Iridaceae | Belamcanda chinensis  | Ref. |
| Plantae | Iridaceae | Iris dichotoma | Ref. |
| Plantae | Iridaceae | Iris florentina | Ref. |
| Plantae | Iridaceae | Iris germanica  | Ref. |
| Plantae | Iridaceae | Iris kumanonensis | Ref. |
| Plantae | Iridaceae | Iris kumaonensis  | Ref. |
| Plantae | Iridaceae | Iris nepalensis  | Ref. |
| Plantae | Iridaceae | Iris soforana | Ref. |
| Plantae | Iridaceae | Iris tectorum  | Ref. |
| Plantae | Iridaceae | Iris tingitana | Ref. |
| Plantae | Iridaceae | Iris unguicularis | Ref. |
| - | - | Belameanda chinensis | Ref. |
|
|
zoom in
| Organism | Juniperus macropoda | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Gopinath,Indian J.Chem.,1,(1963),187
Arisawa,Chem.Pharm.Bull.,24,(1976),815 |
|---|
|