| Name |
Odorantin Odoratine Diptodoratidin 5,6,7-Trimethoxy-3',4'-methylenedioxyisoflavone |
| Formula |
C19H16O7 |
| Mw |
356.08960287 |
| CAS RN |
51986-39-1 |
| C_ID |
C00009482
, 
|
| InChIKey |
FXRYTZLSNFFEHZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H16O7/c1-21-15-7-14-16(19(23-3)18(15)22-2)17(20)11(8-24-14)10-4-5-12-13(6-10)26-9-25-12/h4-8H,9H2,1-3H3 |
| SMILES |
COc1cc2occ(-c3ccc4c(c3)OCO4)c(=O)c2c(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Cordia africana  | Ref. |
| Plantae | Fabaceae | Dipteryx odorata  | Ref. |
| Plantae | Fabaceae | Millettia griffoniana | Ref. |
|
|
zoom in
| Organism | Dipteryx odorata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Campbell,J.Chem.Soc.Perkin Trans.,1,(1973),2222
Nakano,J.Chem.Soc.Perkin Trans.,1,(1979),2107 |
|---|
|