| Name |
Dipteryxine Isoplatycarpanetin 7-Hydroxy-5,6-dimethoxy-3',4'-methylenedioxyisoflavone |
| Formula |
C18H14O7 |
| Mw |
342.0739528 |
| CAS RN |
68862-19-1 |
| C_ID |
C00009476
, 
|
| InChIKey |
MJQUWACFHNKSDV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H14O7/c1-21-17-11(19)6-14-15(18(17)22-2)16(20)10(7-23-14)9-3-4-12-13(5-9)25-8-24-12/h3-7,19H,8H2,1-2H3 |
| SMILES |
COc1c(O)cc2occ(-c3ccc4c(c3)OCO4)c(=O)c2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cladrastis platycarpa | Ref. |
| Plantae | Fabaceae | Cladrastis sikokiana | Ref. |
| Plantae | Fabaceae | Dipteryx odorata  | Ref. |
|
|
zoom in
| Organism | Cladrastis sikokiana | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ohashi,J.Jpn Wood Res.Soc.,24,(1978),750
Nakano,J.Chem.Soc.Perkin Trans.,1,(1979),2107 |
|---|
|