| Name |
3'-Hydroxy-8-O-methylretusin |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
53947-99-2 |
| C_ID |
C00009408
, 
|
| InChIKey |
YYWSNCLFZSMGCM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-14-6-3-9(7-13(14)19)11-8-23-16-10(15(11)20)4-5-12(18)17(16)22-2/h3-8,18-19H,1-2H3 |
| SMILES |
COc1ccc(-c2coc3c(OC)c(O)ccc3c2=O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dipteryx odorata  | Ref. |
| Plantae | Fabaceae | Myroxylon balsamum  | Ref. |
| Plantae | Fabaceae | Xanthocercis zambesiaca | Ref. |
|
|
zoom in
| Organism | Myroxylon balsamum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Braga de Oliveira,Phytochem.,17,(1978),593
Harper,Phytochem.,15,(1976),1019 |
|---|
|