| Name |
Cladrin 7-Hydroxy-3',4'-dimethoxyisoflavone |
| Formula |
C17H14O5 |
| Mw |
298.08412356 |
| CAS RN |
24160-14-3 |
| C_ID |
C00009398
, 
|
| InChIKey |
VFZIJLPRJAQGFO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O5/c1-20-14-6-3-10(7-16(14)21-2)13-9-22-15-8-11(18)4-5-12(15)17(13)19/h3-9,18H,1-2H3 |
| SMILES |
COc1ccc(-c2coc3cc(O)ccc3c2=O)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cladrastis kentukea | Ref. |
| Plantae | Fabaceae | Cladrastis platycarpa | Ref. |
| Plantae | Fabaceae | Cladrastis sikokiana | Ref. |
| Plantae | Fabaceae | Sophora secundiflora  | Ref. |
|
|
zoom in
| Organism | Cladrastis platycarpa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ohashi,J.Jpn.Wood Res.Soc.,24,(1978),750
Shamma,Tetrahedron,25,(1969),3887 |
|---|
|