| Name |
Pseudobaptigenin methyl ether 7-Methoxy-3',4'-methylenedioxyisoflavone |
| Formula |
C17H12O5 |
| Mw |
296.06847349 |
| CAS RN |
4253-04-7 |
| C_ID |
C00009397
, 
|
| InChIKey |
PCCZMNIBWCKFBC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H12O5/c1-19-11-3-4-12-15(7-11)20-8-13(17(12)18)10-2-5-14-16(6-10)22-9-21-14/h2-8H,9H2,1H3 |
| SMILES |
COc1ccc2c(=O)c(-c3ccc4c(c3)OCO4)coc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Ateleia herbert-smithii | Ref. |
| Plantae | Fabaceae | Calopogonium mucunoides | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
|
|
zoom in
| Organism | Calopogonium mucunoides | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Vilain,Bull.Soc.R.Sci.Liege,45,(1976),468 |
|---|
|