| Name |
Isoformononetin |
| Formula |
C16H12O4 |
| Mw |
268.07355887 |
| CAS RN |
486-63-5 |
| C_ID |
C00009382
, 
|
| InChIKey |
LNIQZRIHAMVRJA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O4/c1-19-12-6-7-13-15(8-12)20-9-14(16(13)18)10-2-4-11(17)5-3-10/h2-9,17H,1H3 |
| SMILES |
COc1ccc2c(=O)c(-c3ccc(O)cc3)coc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Machaerium villosum | Ref. |
| Plantae | Fabaceae | Pisum sativum | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
| Organism | Glycine max |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ingham,Phytochem.,20,(1981),,795 |
|---|
|
