| Name |
Cinnamtannin B2 |
| Formula |
C60H48O24 |
| Mw |
1152.25355247 |
| CAS RN |
88038-12-4 |
| C_ID |
C00009308
, 
|
| InChIKey |
QRQAODSINXAOBF-RJYPEQTLNA-N |
| InChICode |
InChI=1S/C60H48O24/c61-23-13-34(71)42-40(14-23)80-54(20-2-6-26(63)31(68)10-20)51(77)48(42)45-36(73)17-37(74)46-50-47-41(83-60(59(50)79,84-58(45)46)22-4-8-28(65)33(70)12-22)18-38(75)44-49(52(78)55(82-57(44)47)21-3-7-27(64)32(69)11-21)43-35(72)16-29(66)24-15-39(76)53(81-56(24)43)19-1-5-25(62)30(67)9-19/h1-14,16-18,39,48-55,59,61-79H,15H2/t39-,48-,49-,50-,51-,52-,53+,54-,55-,59-,60-/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@@]1(c3ccc(O)c(O)c3)Oc3cc(O)c4c(c3[C@@H]2[C@H]1O)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]4c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Vaccinium vitis-idaea  | Ref. |
| Plantae | Gleicheniaceae | Dicranopteris pedata | Ref. |
| Plantae | Lauraceae | Cinnamomum sieboldii  | Ref. |
| Plantae | Lauraceae | Cinnamomum zeylanicum  | Ref. |
| Plantae | Lauraceae | Lindera umbellata  | Ref. |
| Plantae | Rubiaceae | Pavetta owariensis  | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum  | Ref. |
|
|
zoom in
| Organism | Dicranopteris pedata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Nonaka,J.Chem.Soc.Perkin Trans,1,(1983),2139
Balde,Phytochem.,38,(1995),719 |
|---|
|