| Name |
Ephedrannin A |
| Formula |
C30H20O11 |
| Mw |
556.10056148 |
| CAS RN |
82001-39-6 |
| C_ID |
C00009274
, 
|
| InChIKey |
GPBSBBVDERLESN-KWRBWDCJNA-N |
| InChICode |
InChI=1S/C30H20O11/c31-14-5-1-12(2-6-14)27-26(37)25(36)22-18(35)11-20-23(28(22)39-27)24-21-17(34)9-16(33)10-19(21)40-30(41-20,29(24)38)13-3-7-15(32)8-4-13/h1-11,24,29,31-35,37-38H/t24-,29-,30+/m0/s1 |
| SMILES |
O=c1c(O)c(-c2ccc(O)cc2)oc2c3c(cc(O)c12)O[C@@]1(c2ccc(O)cc2)Oc2cc(O)cc(O)c2[C@@H]3[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Ephedraceae | Ephedra sp. | Ref. |
| Plantae | Rosaceae | Prunus armeniaca | Ref. |
|
|
zoom in
| Organism | Ephedra sp. |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Hikino,Tetrahedron Lett.,23,(1982),673 |
|---|
|
