| Name |
3-O-Galloylepicatechin-(4beta->8)-epicatechin |
| Formula |
C37H30O16 |
| Mw |
730.15338491 |
| CAS RN |
109280-47-9 |
| C_ID |
C00009208
, 
|
| InChIKey |
BXWABJPTCUDBMM-TVMILSLQNA-N |
| InChICode |
InChI=1S/C37H30O16/c38-16-9-23(44)29-28(10-16)51-34(14-2-4-19(40)22(43)6-14)36(53-37(50)15-7-25(46)32(49)26(47)8-15)31(29)30-24(45)12-20(41)17-11-27(48)33(52-35(17)30)13-1-3-18(39)21(42)5-13/h1-10,12,27,31,33-34,36,38-49H,11H2/t27-,31+,33-,34+,36+/m0/s1 |
| SMILES |
O=C(O[C@@H]1[C@@H](c2c(O)cc(O)c3c2O[C@H](c2ccc(O)c(O)c2)[C@H](O)C3)c2c(O)cc(O)cc2O[C@@H]1c1ccc(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Rhododendron sp. | Ref. |
| Plantae | Fagaceae | Quercus falcata | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Quercus falcata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
da Silva,Phytochem.,30,(1991),1259
Thinh,Khim.Prir.Soedin.,(1982),336 |
|---|
|