| Name |
Cinnamtannin A1 |
| Formula |
C60H50O24 |
| Mw |
1154.26920253 |
| CAS RN |
86631-38-1 |
| C_ID |
C00009107
, 
|
| InChIKey |
QFLMUASKTWGRQE-AEGPMQOXNA-N |
| InChICode |
InChI=1S/C60H50O24/c61-23-13-34(71)42-41(14-23)81-55(20-2-6-26(63)31(68)10-20)51(78)48(42)44-36(73)17-38(75)46-50(53(80)57(83-59(44)46)22-4-8-28(65)33(70)12-22)47-39(76)18-37(74)45-49(52(79)56(84-60(45)47)21-3-7-27(64)32(69)11-21)43-35(72)16-29(66)24-15-40(77)54(82-58(24)43)19-1-5-25(62)30(67)9-19/h1-14,16-18,40,48-57,61-80H,15H2/t40-,48+,49+,50+,51+,52+,53+,54+,55+,56+,57+/m0/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dioscoreaceae | Dioscorea cirrhosa | Ref. |
| Plantae | Lauraceae | Cinnamomum cassia  | Ref. |
| Plantae | Malvaceae | Theobroma cacao  | Ref. |
| Plantae | Pinaceae | Pseudotsuga menziesii | Ref. |
| Plantae | Rosaceae | Crataegus oxyacantha  | Ref. |
| Plantae | Rosaceae | Rhaphiolepis umbellata | Ref. |
|
|
zoom in
| Organism | Cinnamomum cassia | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Kolodziej,J.Chem.Soc.Pharm.Bull.,34,(1986),633 |
|---|
|