| Name |
Arecatannin B1 |
| Formula |
C45H38O18 |
| Mw |
866.20581441 |
| CAS RN |
79763-28-3 |
| C_ID |
C00009089
, 
|
| InChIKey |
PBYRKMXDROOXMU-YRHGLQAANA-N |
| InChICode |
InChI=1S/C45H38O18/c46-18-10-26(53)33-32(11-18)62-43(16-2-5-21(48)24(51)8-16)40(59)37(33)35-27(54)13-28(55)36-38(41(60)44(63-45(35)36)17-3-6-22(49)25(52)9-17)34-29(56)14-31-19(39(34)58)12-30(57)42(61-31)15-1-4-20(47)23(50)7-15/h1-11,13-14,30,37-38,40-44,46-60H,12H2/t30-,37-,38+,40-,41-,42-,43-,44-/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc2c(c1O)C[C@H](O)[C@@H](c1ccc(O)c(O)c1)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Betulaceae | Betula spp. | Ref. |
| Plantae | Cupressaceae | Thujopsis dolabrata | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Palmae | Areca catechu  | Ref. |
| Plantae | Pinaceae | Pinus taeda | Ref. |
| Plantae | Salicaceae | Salix spp. | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Thujopsis dolabrata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Nonaka,J.Chem.Soc.Chem.Commun.,(1981),781
Hemingway,J.Chem.Soc.Perkin Trans.,1,(1982),1209 |
|---|
|