| Name |
ent-Epicatechin-(4alpha->8)-ent-epicatechin |
| Formula |
C30H26O12 |
| Mw |
578.1424263 |
| CAS RN |
88314-64-1 |
| C_ID |
C00009080
, 
|
| InChIKey |
XFZJEEAOWLFHDH-ZPNYQRGRNA-N |
| InChICode |
InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26+,27+,28+,29+/m1/s1 |
| SMILES |
Oc1cc(O)c2c(c1)O[C@@H](c1ccc(O)c(O)c1)[C@@H](O)[C@@H]2c1c(O)cc(O)c2c1O[C@@H](c1ccc(O)c(O)c1)[C@@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cassia fistula  | Ref. |
| Plantae | Malpighiaceae | Byrsonima crassifolia  | Ref. |
| Plantae | Palmae | Chamaerops humilis  | Ref. |
| Plantae | Palmae | Metroxylon sagu  | Ref. |
|
|
zoom in
| Organism | Byrsonima crassifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Delle Monache,Gazz Chim.Ital.,101,(1971),387
Kashiwada,Chem.Pharm.Bull.,38,(1990),888 |
|---|
|